C30H29N3O4 — CID 54529682
2-anilino-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid (PubChem CID 54529682) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-anilino-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-anilino-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54529682 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 2-anilino-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid |
| SMILES | CC(=NOCCOc1ccc(CC(Nc2ccccc2)C(=O)O)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C30H29N3O4/c1-22(24-12-14-25(15-13-24)28-9-5-6-18-31-28)33-37-20-19-36-27-16-10-23(11-17-27)21-29(30(34)35)32-26-7-3-2-4-8-26/h2-18,29,32H,19-21H2,1H3,(H,34,35) |
| InChIKey | YVPQYZPJNPSXQD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|