C34H42N2O6 — CID 91174198
ethyl (2S)-2-[[4-[4-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butoxy]phenyl]benzoyl]amino]-3-phenylpropanoate (PubChem CID 91174198) has the molecular formula C34H42N2O6 and a molecular weight of 574.72 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[4-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butoxy]phenyl]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[4-[4-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butoxy]phenyl]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91174198 |
| Molecular Formula | C34H42N2O6 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | ethyl (2S)-2-[[4-[4-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]butoxy]phenyl]benzoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(-c2ccc(OCCCCNCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H42N2O6/c1-5-40-33(39)30(23-25-11-7-6-8-12-25)36-32(38)28-15-13-26(14-16-28)27-17-19-29(20-18-27)41-22-10-9-21-35-24-31(37)42-34(2,3)4/h6-8,11-20,30,35H,5,9-10,21-24H2,1-4H3,(H,36,38)/t30-/m0/s1 |
| InChIKey | QWHUZSLKUGJTHA-PMERELPUSA-N |
| XLogP | 5.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|