C31H27N3O5S — CID 18625956
methyl 2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate (PubChem CID 18625956) has the molecular formula C31H27N3O5S and a molecular weight of 553.64 g/mol. Its IUPAC name is methyl 2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 18625956 |
| Molecular Formula | C31H27N3O5S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | methyl 2-(1,3-benzoxazol-2-ylsulfanyl)-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNC(=O)c2ccc(-c3ccccn3)cc2)cc1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C31H27N3O5S/c1-37-30(36)28(40-31-34-26-7-2-3-8-27(26)39-31)20-21-9-15-24(16-10-21)38-19-18-33-29(35)23-13-11-22(12-14-23)25-6-4-5-17-32-25/h2-17,28H,18-20H2,1H3,(H,33,35) |
| InChIKey | LAYRJCAFCWNFEC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|