C12H17N5O — CID 135993055
3-azido-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 135993055) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-azido-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-azido-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 135993055 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-azido-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C12H17N5O/c1-17(2)8-4-7-14-12(18)10-5-3-6-11(9-10)15-16-13/h3,5-6,9H,4,7-8H2,1-2H3,(H,14,18) |
| InChIKey | MDBZZNKKFBOLAW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|