C11H16FN3O — CID 110474763
N-[3-(dimethylamino)propyl]-3-fluoropyridine-2-carboxamide (PubChem CID 110474763) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 110474763 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-fluoropyridine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ncccc1F |
| InChI | InChI=1S/C11H16FN3O/c1-15(2)8-4-7-14-11(16)10-9(12)5-3-6-13-10/h3,5-6H,4,7-8H2,1-2H3,(H,14,16) |
| InChIKey | GODJWHPKRTVINK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|