C14H20FN3O2 — CID 108524813
N-[3-(dimethylamino)propyl]-N'-[(2-fluorophenyl)methyl]oxamide (PubChem CID 108524813) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-[(2-fluorophenyl)methyl]oxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N'-[(2-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108524813 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-[(2-fluorophenyl)methyl]oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C14H20FN3O2/c1-18(2)9-5-8-16-13(19)14(20)17-10-11-6-3-4-7-12(11)15/h3-4,6-7H,5,8-10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | PVSIXSDSIUXJGP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|