C18H26FN3O2 — CID 109133984
2-N-[3-(dimethylamino)propyl]-1-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109133984) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-1-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-1-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109133984 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-1-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)C1CC1C(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C18H26FN3O2/c1-22(2)11-5-9-20-17(23)14-12-15(14)18(24)21-10-8-13-6-3-4-7-16(13)19/h3-4,6-7,14-15H,5,8-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FQXUTQSSZFECNU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|