C20H25FN4O2 — CID 109083889
4-N-[3-(dimethylamino)propyl]-2-N-[2-(2-fluorophenyl)ethyl]pyridine-2,4-dicarboxamide (PubChem CID 109083889) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-2-N-[2-(2-fluorophenyl)ethyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-2-N-[2-(2-fluorophenyl)ethyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083889 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-2-N-[2-(2-fluorophenyl)ethyl]pyridine-2,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccnc(C(=O)NCCc2ccccc2F)c1 |
| InChI | InChI=1S/C20H25FN4O2/c1-25(2)13-5-10-23-19(26)16-9-11-22-18(14-16)20(27)24-12-8-15-6-3-4-7-17(15)21/h3-4,6-7,9,11,14H,5,8,10,12-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HXAYUTBJRCGUPI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|