C20H26N4O2 — CID 109084067
2-N-[3-(dimethylamino)propyl]-4-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109084067) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109084067 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)c1ccnc(C(=O)NCCCN(C)C)c1 |
| InChI | InChI=1S/C20H26N4O2/c1-4-15-8-5-6-9-17(15)23-19(25)16-10-12-21-18(14-16)20(26)22-11-7-13-24(2)3/h5-6,8-10,12,14H,4,7,11,13H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | JNJMBKLYUTYJDL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|