C23H24N4O2 — CID 109092240
4-N-[4-(dimethylamino)phenyl]-2-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109092240) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-N-[4-(dimethylamino)phenyl]-2-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[4-(dimethylamino)phenyl]-2-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109092240 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-N-[4-(dimethylamino)phenyl]-2-N-(2-ethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc(C(=O)Nc2ccc(N(C)C)cc2)ccn1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-16-7-5-6-8-20(16)26-23(29)21-15-17(13-14-24-21)22(28)25-18-9-11-19(12-10-18)27(2)3/h5-15H,4H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | RAYPNBYVYCPTJJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|