C13H17FN2O4 — CID 108509953
N-[(2-fluorophenyl)methyl]-N',N'-bis(2-hydroxyethyl)oxamide (PubChem CID 108509953) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N',N'-bis(2-hydroxyethyl)oxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N',N'-bis(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108509953 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N',N'-bis(2-hydroxyethyl)oxamide |
| SMILES | O=C(NCc1ccccc1F)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C13H17FN2O4/c14-11-4-2-1-3-10(11)9-15-12(19)13(20)16(5-7-17)6-8-18/h1-4,17-18H,5-9H2,(H,15,19) |
| InChIKey | HGSZVXNINAUNER-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|