C21H21F2N3O2 — CID 171446140
N-[3-(dimethylamino)propyl]-2,6-difluoro-4-(8-hydroxyquinolin-6-yl)benzamide (PubChem CID 171446140) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,6-difluoro-4-(8-hydroxyquinolin-6-yl)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,6-difluoro-4-(8-hydroxyquinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 171446140 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,6-difluoro-4-(8-hydroxyquinolin-6-yl)benzamide |
| SMILES | CN(C)CCCNC(=O)c1c(F)cc(-c2cc(O)c3ncccc3c2)cc1F |
| InChI | InChI=1S/C21H21F2N3O2/c1-26(2)8-4-7-25-21(28)19-16(22)10-15(11-17(19)23)14-9-13-5-3-6-24-20(13)18(27)12-14/h3,5-6,9-12,27H,4,7-8H2,1-2H3,(H,25,28) |
| InChIKey | SXQHHLLQSPJFSH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|