C19H21N3O2S — CID 171446127
N-[3-(dimethylamino)propyl]-5-(8-hydroxyquinolin-6-yl)thiophene-2-carboxamide (PubChem CID 171446127) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5-(8-hydroxyquinolin-6-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5-(8-hydroxyquinolin-6-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 171446127 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5-(8-hydroxyquinolin-6-yl)thiophene-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cc(O)c3ncccc3c2)s1 |
| InChI | InChI=1S/C19H21N3O2S/c1-22(2)10-4-9-21-19(24)17-7-6-16(25-17)14-11-13-5-3-8-20-18(13)15(23)12-14/h3,5-8,11-12,23H,4,9-10H2,1-2H3,(H,21,24) |
| InChIKey | QNWHQAJUKRMJMU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|