C27H29N3O3S — CID 171446078
N-[3-(dimethylamino)propyl]-5-[8-[(4-methoxyphenyl)methoxy]quinolin-6-yl]thiophene-3-carboxamide (PubChem CID 171446078) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5-[8-[(4-methoxyphenyl)methoxy]quinolin-6-yl]thiophene-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5-[8-[(4-methoxyphenyl)methoxy]quinolin-6-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 171446078 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5-[8-[(4-methoxyphenyl)methoxy]quinolin-6-yl]thiophene-3-carboxamide |
| SMILES | COc1ccc(COc2cc(-c3cc(C(=O)NCCCN(C)C)cs3)cc3cccnc23)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-30(2)13-5-12-29-27(31)22-16-25(34-18-22)21-14-20-6-4-11-28-26(20)24(15-21)33-17-19-7-9-23(32-3)10-8-19/h4,6-11,14-16,18H,5,12-13,17H2,1-3H3,(H,29,31) |
| InChIKey | BTWAMIMPEAQKGB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|