C27H14F8N8O8 — CID 160587020
(2,5-dioxopyrrol-1-yl)methyl 4-azido-2,3,5,6-tetrafluorobenzoate;2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 160587020) has the molecular formula C27H14F8N8O8 and a molecular weight of 730.44 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl)methyl 4-azido-2,3,5,6-tetrafluorobenzoate;2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | (2,5-dioxopyrrol-1-yl)methyl 4-azido-2,3,5,6-tetrafluorobenzoate;2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 160587020 |
| Molecular Formula | C27H14F8N8O8 |
| Molecular Weight | 730.44 g/mol |
| Exact Mass | 730.08 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl)methyl 4-azido-2,3,5,6-tetrafluorobenzoate;2-[(2-methylidene-5-oxopyrrol-1-yl)methoxy]ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | C=C1C=CC(=O)N1COCCOC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F.[N-]=[N+]=Nc1c(F)c(F)c(C(=O)OCN2C(=O)C=CC2=O)c(F)c1F |
| InChI | InChI=1S/C15H10F4N4O4.C12H4F4N4O4/c1-7-2-3-8(24)23(7)6-26-4-5-27-15(25)9-10(16)12(18)14(21-22-20)13(19)11(9)17;13-7-6(8(14)10(16)11(9(7)15)18-19-17)12(23)24-3-20-4(21)1-2-5(20)22/h2-3H,1,4-6H2;1-2H,3H2 |
| InChIKey | RCNFVKFSEPYAFT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 217.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|