C38H20F8N6O7 — CID 160587439
4-azido-2,3,5,6-tetrafluorobenzoic acid;4-(4-hydroxyphenyl)phenol;[4-(4-hydroxyphenyl)phenyl] 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 160587439) has the molecular formula C38H20F8N6O7 and a molecular weight of 824.60 g/mol. Its IUPAC name is 4-azido-2,3,5,6-tetrafluorobenzoic acid;4-(4-hydroxyphenyl)phenol;[4-(4-hydroxyphenyl)phenyl] 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | 4-azido-2,3,5,6-tetrafluorobenzoic acid;4-(4-hydroxyphenyl)phenol;[4-(4-hydroxyphenyl)phenyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 160587439 |
| Molecular Formula | C38H20F8N6O7 |
| Molecular Weight | 824.60 g/mol |
| Exact Mass | 824.13 |
| IUPAC Name | 4-azido-2,3,5,6-tetrafluorobenzoic acid;4-(4-hydroxyphenyl)phenol;[4-(4-hydroxyphenyl)phenyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | Oc1ccc(-c2ccc(O)cc2)cc1.[N-]=[N+]=Nc1c(F)c(F)c(C(=O)O)c(F)c1F.[N-]=[N+]=Nc1c(F)c(F)c(C(=O)Oc2ccc(-c3ccc(O)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C19H9F4N3O3.C12H10O2.C7HF4N3O2/c20-14-13(15(21)17(23)18(16(14)22)25-26-24)19(28)29-12-7-3-10(4-8-12)9-1-5-11(27)6-2-9;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;8-2-1(7(15)16)3(9)5(11)6(4(2)10)13-14-12/h1-8,27H;1-8,13-14H;(H,15,16) |
| InChIKey | RCORIWFLVDAUTJ-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 221.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.60 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|