C16H10F4N4O4 — CID 21151166
2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 21151166) has the molecular formula C16H10F4N4O4 and a molecular weight of 398.27 g/mol. Its IUPAC name is 2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 21151166 |
| Molecular Formula | C16H10F4N4O4 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-[(4-azido-2,3,5,6-tetrafluorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)NC(Cc2ccc(O)cc2)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C16H10F4N4O4/c17-10-9(11(18)13(20)14(12(10)19)23-24-21)15(26)22-8(16(27)28)5-6-1-3-7(25)4-2-6/h1-4,8,25H,5H2,(H,22,26)(H,27,28) |
| InChIKey | OTOYSZBRLQZOQG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|