C18H4F18N2S2Sn — CID 11967145
5,5-bis[2,4,6-tris(trifluoromethyl)phenyl]-1,3lambda4-dithia-2,4-diaza-5-stannacyclopenta-2,3-diene (PubChem CID 11967145) has the molecular formula C18H4F18N2S2Sn and a molecular weight of 773.05 g/mol. Its IUPAC name is 5,5-bis[2,4,6-tris(trifluoromethyl)phenyl]-1,3lambda4-dithia-2,4-diaza-5-stannacyclopenta-2,3-diene.
| Compound Name | 5,5-bis[2,4,6-tris(trifluoromethyl)phenyl]-1,3lambda4-dithia-2,4-diaza-5-stannacyclopenta-2,3-diene |
|---|---|
| PubChem CID | 11967145 |
| Molecular Formula | C18H4F18N2S2Sn |
| Molecular Weight | 773.05 g/mol |
| Exact Mass | 773.86 |
| IUPAC Name | 5,5-bis[2,4,6-tris(trifluoromethyl)phenyl]-1,3lambda4-dithia-2,4-diaza-5-stannacyclopenta-2,3-diene |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c([Sn]2(c3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)N=S=NS2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C9H2F9.HN2S2.Sn/c2*10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16,17)18;1-4-2-3;/h2*1-2H;3H;/q;;-1;+2/p-1 |
| InChIKey | AJCLAMCMZUWXJM-UHFFFAOYSA-M |
| XLogP | 8.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.05 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|