C15H14O2S — CID 123193677
1-oxo-6-penta-1,3-dienyl-5-sulfanyl-2,3-dihydroindene-4-carbaldehyde (PubChem CID 123193677) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 1-oxo-6-penta-1,3-dienyl-5-sulfanyl-2,3-dihydroindene-4-carbaldehyde.
| Compound Name | 1-oxo-6-penta-1,3-dienyl-5-sulfanyl-2,3-dihydroindene-4-carbaldehyde |
|---|---|
| PubChem CID | 123193677 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-oxo-6-penta-1,3-dienyl-5-sulfanyl-2,3-dihydroindene-4-carbaldehyde |
| SMILES | CC=CC=Cc1cc2c(c(C=O)c1S)CCC2=O |
| InChI | InChI=1S/C15H14O2S/c1-2-3-4-5-10-8-12-11(6-7-14(12)17)13(9-16)15(10)18/h2-5,8-9,18H,6-7H2,1H3 |
| InChIKey | HZUGQBMUPAPNQX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|