C12H11NO2 — CID 169481923
3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enamide (PubChem CID 169481923) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enamide.
| Compound Name | 3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 169481923 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enamide |
| SMILES | NC(=O)C=Cc1cccc2c1CCC2=O |
| InChI | InChI=1S/C12H11NO2/c13-12(15)7-4-8-2-1-3-10-9(8)5-6-11(10)14/h1-4,7H,5-6H2,(H2,13,15) |
| InChIKey | DJCKYVNAQVRUMD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|