About 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile
4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile (PubChem CID 170799851) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile.
Molecular Properties
| Compound Name | 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile |
| PubChem CID | 170799851 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile |
| SMILES | N#CCC=Cc1cccc2c1CCC2=O |
| InChI | InChI=1S/C13H11NO/c14-9-2-1-4-10-5-3-6-12-11(10)7-8-13(12)15/h1,3-6H,2,7-8H2 |
| InChIKey | JJJVDHGBXSNMRS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile?
The IUPAC name of 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile (CID 170799851) is 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile.
What is the SMILES notation for 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile?
The canonical SMILES for 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile is N#CCC=Cc1cccc2c1CCC2=O.
What is the InChIKey of 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile?
The InChIKey is JJJVDHGBXSNMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c14-9-2-1-4-10-5-3-6-12-11(10)7-8-13(12)15/h1,3-6H,2,7-8H2.
What are the key properties of 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile?
4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile has a molecular weight of 197.24 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-oxo-2,3-dihydroinden-4-yl)but-3-enenitrile is sourced from PubChem (CID 170799851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).