C14H15NO2 — CID 169465620
N-[3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enyl]acetamide (PubChem CID 169465620) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465620 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[3-(1-oxo-2,3-dihydroinden-4-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1cccc2c1CCC2=O |
| InChI | InChI=1S/C14H15NO2/c1-10(16)15-9-3-5-11-4-2-6-13-12(11)7-8-14(13)17/h2-6H,7-9H2,1H3,(H,15,16) |
| InChIKey | VEABCIYGLAUCCL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |