C8H5ClFNO — CID 130064719
6-chloro-4-fluoro-2,3-dihydroisoindol-1-one (PubChem CID 130064719) has the molecular formula C8H5ClFNO and a molecular weight of 185.59 g/mol. Its IUPAC name is 6-chloro-4-fluoro-2,3-dihydroisoindol-1-one.
| Compound Name | 6-chloro-4-fluoro-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 130064719 |
| Molecular Formula | C8H5ClFNO |
| Molecular Weight | 185.59 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 6-chloro-4-fluoro-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(F)cc(Cl)cc21 |
| InChI | InChI=1S/C8H5ClFNO/c9-4-1-5-6(7(10)2-4)3-11-8(5)12/h1-2H,3H2,(H,11,12) |
| InChIKey | TZLZNBHSERSHTF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |