C9H6ClNO2 — CID 172589120
7-chloro-3-oxo-1,2-dihydroisoindole-5-carbaldehyde (PubChem CID 172589120) has the molecular formula C9H6ClNO2 and a molecular weight of 195.61 g/mol. Its IUPAC name is 7-chloro-3-oxo-1,2-dihydroisoindole-5-carbaldehyde.
| Compound Name | 7-chloro-3-oxo-1,2-dihydroisoindole-5-carbaldehyde |
|---|---|
| PubChem CID | 172589120 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 7-chloro-3-oxo-1,2-dihydroisoindole-5-carbaldehyde |
| SMILES | O=Cc1cc(Cl)c2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C9H6ClNO2/c10-8-2-5(4-12)1-6-7(8)3-11-9(6)13/h1-2,4H,3H2,(H,11,13) |
| InChIKey | JDLAYUMEYGWYCS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|