C8H5FN4O — CID 169326285
6-azido-4-fluoro-2,3-dihydroisoindol-1-one (PubChem CID 169326285) has the molecular formula C8H5FN4O and a molecular weight of 192.15 g/mol. Its IUPAC name is 6-azido-4-fluoro-2,3-dihydroisoindol-1-one.
| Compound Name | 6-azido-4-fluoro-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 169326285 |
| Molecular Formula | C8H5FN4O |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 6-azido-4-fluoro-2,3-dihydroisoindol-1-one |
| SMILES | [N-]=[N+]=Nc1cc(F)c2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C8H5FN4O/c9-7-2-4(12-13-10)1-5-6(7)3-11-8(5)14/h1-2H,3H2,(H,11,14) |
| InChIKey | ZGIOJDDKZVAORC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|