C13H7ClN4O2 — CID 169326410
8-azido-3-chloro-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 169326410) has the molecular formula C13H7ClN4O2 and a molecular weight of 286.68 g/mol. Its IUPAC name is 8-azido-3-chloro-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 8-azido-3-chloro-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 169326410 |
| Molecular Formula | C13H7ClN4O2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 8-azido-3-chloro-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1)C(=O)Nc1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C13H7ClN4O2/c14-7-1-3-12-10(5-7)16-13(19)9-6-8(17-18-15)2-4-11(9)20-12/h1-6H,(H,16,19) |
| InChIKey | CYJIPRKHIDKKIC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|