C11H12FN5O — CID 91383659
1-(4-azido-2-fluorophenyl)-1,4-diazepan-5-one (PubChem CID 91383659) has the molecular formula C11H12FN5O and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-(4-azido-2-fluorophenyl)-1,4-diazepan-5-one.
| Compound Name | 1-(4-azido-2-fluorophenyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 91383659 |
| Molecular Formula | C11H12FN5O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(4-azido-2-fluorophenyl)-1,4-diazepan-5-one |
| SMILES | [N-]=[N+]=Nc1ccc(N2CCNC(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C11H12FN5O/c12-9-7-8(15-16-13)1-2-10(9)17-5-3-11(18)14-4-6-17/h1-2,7H,3-6H2,(H,14,18) |
| InChIKey | MYANCBQPDYMQBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|