C11H12ClFN2O2 — CID 168640025
6-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-2,3-dihydroisoindol-1-one (PubChem CID 168640025) has the molecular formula C11H12ClFN2O2 and a molecular weight of 258.68 g/mol. Its IUPAC name is 6-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 168640025 |
| Molecular Formula | C11H12ClFN2O2 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 6-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(F)cc(NCC(O)CCl)cc21 |
| InChI | InChI=1S/C11H12ClFN2O2/c12-3-7(16)4-14-6-1-8-9(10(13)2-6)5-15-11(8)17/h1-2,7,14,16H,3-5H2,(H,15,17) |
| InChIKey | ITTUNZDHXFTALE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|