C14H19ClN2O2 — CID 168640091
6-[(3-chloro-2-hydroxypropyl)amino]-4,4-dimethyl-1,2-dihydroisoquinolin-3-one (PubChem CID 168640091) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 6-[(3-chloro-2-hydroxypropyl)amino]-4,4-dimethyl-1,2-dihydroisoquinolin-3-one.
| Compound Name | 6-[(3-chloro-2-hydroxypropyl)amino]-4,4-dimethyl-1,2-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 168640091 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-[(3-chloro-2-hydroxypropyl)amino]-4,4-dimethyl-1,2-dihydroisoquinolin-3-one |
| SMILES | CC1(C)C(=O)NCc2ccc(NCC(O)CCl)cc21 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2)12-5-10(16-8-11(18)6-15)4-3-9(12)7-17-13(14)19/h3-5,11,16,18H,6-8H2,1-2H3,(H,17,19) |
| InChIKey | XQYCJUHWGJOLRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|