C13H19ClN2O — CID 168640587
1-chloro-3-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]propan-2-ol (PubChem CID 168640587) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 1-chloro-3-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 168640587 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-chloro-3-[(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]propan-2-ol |
| SMILES | CC1CCc2cc(NCC(O)CCl)ccc2N1 |
| InChI | InChI=1S/C13H19ClN2O/c1-9-2-3-10-6-11(4-5-13(10)16-9)15-8-12(17)7-14/h4-6,9,12,15-17H,2-3,7-8H2,1H3 |
| InChIKey | LQPQSAAWEDYNPF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|