C13H17ClN2O — CID 168638013
1-chloro-3-[(2,3-dimethyl-1H-indol-5-yl)amino]propan-2-ol (PubChem CID 168638013) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 1-chloro-3-[(2,3-dimethyl-1H-indol-5-yl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(2,3-dimethyl-1H-indol-5-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 168638013 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-chloro-3-[(2,3-dimethyl-1H-indol-5-yl)amino]propan-2-ol |
| SMILES | Cc1[nH]c2ccc(NCC(O)CCl)cc2c1C |
| InChI | InChI=1S/C13H17ClN2O/c1-8-9(2)16-13-4-3-10(5-12(8)13)15-7-11(17)6-14/h3-5,11,15-17H,6-7H2,1-2H3 |
| InChIKey | WZNZNOPVESZUOY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|