C11H15N3O3 — CID 168593696
6-(2,3-dihydroxypropylamino)-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 168593696) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylamino)-3,4-dihydro-1H-quinazolin-2-one.
| Compound Name | 6-(2,3-dihydroxypropylamino)-3,4-dihydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 168593696 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 6-(2,3-dihydroxypropylamino)-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | O=C1NCc2cc(NCC(O)CO)ccc2N1 |
| InChI | InChI=1S/C11H15N3O3/c15-6-9(16)5-12-8-1-2-10-7(3-8)4-13-11(17)14-10/h1-3,9,12,15-16H,4-6H2,(H2,13,14,17) |
| InChIKey | VGRORCLEHZZZGC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |