C12H16N2O3 — CID 168594667
5-(2,3-dihydroxypropylamino)-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 168594667) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylamino)-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 5-(2,3-dihydroxypropylamino)-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 168594667 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-(2,3-dihydroxypropylamino)-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | O=C1Cc2c(cccc2NCC(O)CO)CN1 |
| InChI | InChI=1S/C12H16N2O3/c15-7-9(16)6-13-11-3-1-2-8-5-14-12(17)4-10(8)11/h1-3,9,13,15-16H,4-7H2,(H,14,17) |
| InChIKey | NEIYZMMMSJNPRQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |