C10H16BNO4 — CID 168597479
[3-(2,3-dihydroxypropylamino)-2-methylphenyl]boronic acid (PubChem CID 168597479) has the molecular formula C10H16BNO4 and a molecular weight of 225.05 g/mol. Its IUPAC name is [3-(2,3-dihydroxypropylamino)-2-methylphenyl]boronic acid.
| Compound Name | [3-(2,3-dihydroxypropylamino)-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 168597479 |
| Molecular Formula | C10H16BNO4 |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [3-(2,3-dihydroxypropylamino)-2-methylphenyl]boronic acid |
| SMILES | Cc1c(NCC(O)CO)cccc1B(O)O |
| InChI | InChI=1S/C10H16BNO4/c1-7-9(11(15)16)3-2-4-10(7)12-5-8(14)6-13/h2-4,8,12-16H,5-6H2,1H3 |
| InChIKey | VUXBMZBWHJASDU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|