C16H25ClN2O — CID 168640106
1-chloro-3-[4-(1,4-dimethylpiperidin-4-yl)anilino]propan-2-ol (PubChem CID 168640106) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 1-chloro-3-[4-(1,4-dimethylpiperidin-4-yl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[4-(1,4-dimethylpiperidin-4-yl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168640106 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-chloro-3-[4-(1,4-dimethylpiperidin-4-yl)anilino]propan-2-ol |
| SMILES | CN1CCC(C)(c2ccc(NCC(O)CCl)cc2)CC1 |
| InChI | InChI=1S/C16H25ClN2O/c1-16(7-9-19(2)10-8-16)13-3-5-14(6-4-13)18-12-15(20)11-17/h3-6,15,18,20H,7-12H2,1-2H3 |
| InChIKey | DASNYPXGQYBPKS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|