C13H18Cl2N2O — CID 168637936
1-chloro-3-(3-chloro-4-pyrrolidin-1-ylanilino)propan-2-ol (PubChem CID 168637936) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-chloro-3-(3-chloro-4-pyrrolidin-1-ylanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(3-chloro-4-pyrrolidin-1-ylanilino)propan-2-ol |
|---|---|
| PubChem CID | 168637936 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-chloro-3-(3-chloro-4-pyrrolidin-1-ylanilino)propan-2-ol |
| SMILES | OC(CCl)CNc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O/c14-8-11(18)9-16-10-3-4-13(12(15)7-10)17-5-1-2-6-17/h3-4,7,11,16,18H,1-2,5-6,8-9H2 |
| InChIKey | CNHZOJLZBCMCAI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|