C15H24N2O4S — CID 168594715
3-(4-methylsulfonyl-3-piperidin-1-ylanilino)propane-1,2-diol (PubChem CID 168594715) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 3-(4-methylsulfonyl-3-piperidin-1-ylanilino)propane-1,2-diol.
| Compound Name | 3-(4-methylsulfonyl-3-piperidin-1-ylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168594715 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-(4-methylsulfonyl-3-piperidin-1-ylanilino)propane-1,2-diol |
| SMILES | CS(=O)(=O)c1ccc(NCC(O)CO)cc1N1CCCCC1 |
| InChI | InChI=1S/C15H24N2O4S/c1-22(20,21)15-6-5-12(16-10-13(19)11-18)9-14(15)17-7-3-2-4-8-17/h5-6,9,13,16,18-19H,2-4,7-8,10-11H2,1H3 |
| InChIKey | HCXOASJEKFGQFV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |