C16H26N2O4S — CID 168594853
3-[3-(4-methylpiperidin-1-yl)-4-methylsulfonylanilino]propane-1,2-diol (PubChem CID 168594853) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 3-[3-(4-methylpiperidin-1-yl)-4-methylsulfonylanilino]propane-1,2-diol.
| Compound Name | 3-[3-(4-methylpiperidin-1-yl)-4-methylsulfonylanilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594853 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[3-(4-methylpiperidin-1-yl)-4-methylsulfonylanilino]propane-1,2-diol |
| SMILES | CC1CCN(c2cc(NCC(O)CO)ccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H26N2O4S/c1-12-5-7-18(8-6-12)15-9-13(17-10-14(20)11-19)3-4-16(15)23(2,21)22/h3-4,9,12,14,17,19-20H,5-8,10-11H2,1-2H3 |
| InChIKey | CZGAUMWNMHLLKR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |