C12H18N2O4S — CID 168594420
N-[3-(2,3-dihydroxypropylamino)phenyl]cyclopropanesulfonamide (PubChem CID 168594420) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N-[3-(2,3-dihydroxypropylamino)phenyl]cyclopropanesulfonamide.
| Compound Name | N-[3-(2,3-dihydroxypropylamino)phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 168594420 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[3-(2,3-dihydroxypropylamino)phenyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(NCC(O)CO)c1)C1CC1 |
| InChI | InChI=1S/C12H18N2O4S/c15-8-11(16)7-13-9-2-1-3-10(6-9)14-19(17,18)12-4-5-12/h1-3,6,11-16H,4-5,7-8H2 |
| InChIKey | OLVNRJVWCBINJK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |