C14H18ClN3O2 — CID 168637689
5-[(3-chloro-2-hydroxypropyl)amino]-2-morpholin-4-ylbenzonitrile (PubChem CID 168637689) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-[(3-chloro-2-hydroxypropyl)amino]-2-morpholin-4-ylbenzonitrile.
| Compound Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-morpholin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 168637689 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-morpholin-4-ylbenzonitrile |
| SMILES | N#Cc1cc(NCC(O)CCl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C14H18ClN3O2/c15-8-13(19)10-17-12-1-2-14(11(7-12)9-16)18-3-5-20-6-4-18/h1-2,7,13,17,19H,3-6,8,10H2 |
| InChIKey | RZGJPKJJNDCIIN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|