C13H17ClN4O3 — CID 168638208
1-chloro-3-[(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)amino]propan-2-ol (PubChem CID 168638208) has the molecular formula C13H17ClN4O3 and a molecular weight of 312.76 g/mol. Its IUPAC name is 1-chloro-3-[(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)amino]propan-2-ol.
| Compound Name | 1-chloro-3-[(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 168638208 |
| Molecular Formula | C13H17ClN4O3 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-chloro-3-[(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)amino]propan-2-ol |
| SMILES | OC(CCl)CNc1ccc(N2CCOCC2)c2nonc12 |
| InChI | InChI=1S/C13H17ClN4O3/c14-7-9(19)8-15-10-1-2-11(13-12(10)16-21-17-13)18-3-5-20-6-4-18/h1-2,9,15,19H,3-8H2 |
| InChIKey | NCZRQTWWIYCESQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|