C17H16FN5O2S — CID 17378320
1-(3-fluorophenyl)-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea (PubChem CID 17378320) has the molecular formula C17H16FN5O2S and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea |
|---|---|
| PubChem CID | 17378320 |
| Molecular Formula | C17H16FN5O2S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea |
| SMILES | Fc1cccc(NC(=S)Nc2ccc(N3CCOCC3)c3nonc23)c1 |
| InChI | InChI=1S/C17H16FN5O2S/c18-11-2-1-3-12(10-11)19-17(26)20-13-4-5-14(16-15(13)21-25-22-16)23-6-8-24-9-7-23/h1-5,10H,6-9H2,(H2,19,20,26) |
| InChIKey | VYKFFOFIDCEJDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|