C14H17N5O2S — CID 17380861
1-cyclopropyl-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea (PubChem CID 17380861) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea.
| Compound Name | 1-cyclopropyl-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea |
|---|---|
| PubChem CID | 17380861 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-cyclopropyl-3-(4-morpholin-4-yl-2,1,3-benzoxadiazol-7-yl)thiourea |
| SMILES | S=C(Nc1ccc(N2CCOCC2)c2nonc12)NC1CC1 |
| InChI | InChI=1S/C14H17N5O2S/c22-14(15-9-1-2-9)16-10-3-4-11(13-12(10)17-21-18-13)19-5-7-20-8-6-19/h3-4,9H,1-2,5-8H2,(H2,15,16,22) |
| InChIKey | OTDGAPNJVCRASN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|