C21H32N4O2S — CID 8654290
1-cyclohexyl-3-(2,4-dimorpholin-4-ylphenyl)thiourea (PubChem CID 8654290) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,4-dimorpholin-4-ylphenyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(2,4-dimorpholin-4-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8654290 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-cyclohexyl-3-(2,4-dimorpholin-4-ylphenyl)thiourea |
| SMILES | S=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)NC1CCCCC1 |
| InChI | InChI=1S/C21H32N4O2S/c28-21(22-17-4-2-1-3-5-17)23-19-7-6-18(24-8-12-26-13-9-24)16-20(19)25-10-14-27-15-11-25/h6-7,16-17H,1-5,8-15H2,(H2,22,23,28) |
| InChIKey | RATXXJPGHNPMOR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|