C16H23ClN2O5 — CID 168639306
2-[4-[(3-chloro-2-hydroxypropyl)amino]-2-methoxyphenoxy]-1-morpholin-4-ylethanone (PubChem CID 168639306) has the molecular formula C16H23ClN2O5 and a molecular weight of 358.82 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-hydroxypropyl)amino]-2-methoxyphenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 168639306 |
| Molecular Formula | C16H23ClN2O5 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[4-[(3-chloro-2-hydroxypropyl)amino]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(NCC(O)CCl)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H23ClN2O5/c1-22-15-8-12(18-10-13(20)9-17)2-3-14(15)24-11-16(21)19-4-6-23-7-5-19/h2-3,8,13,18,20H,4-7,9-11H2,1H3 |
| InChIKey | XBDOACGOSCZSPW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|