C17H20N2O6 — CID 7277925
[(1S)-1-cyanoethyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate (PubChem CID 7277925) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate.
| Compound Name | [(1S)-1-cyanoethyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 7277925 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [(1S)-1-cyanoethyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C#N)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H20N2O6/c1-12(10-18)25-17(21)13-3-4-14(15(9-13)22-2)24-11-16(20)19-5-7-23-8-6-19/h3-4,9,12H,5-8,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | LZUNADWFZATNDG-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |