C15H22ClN3O3 — CID 168636902
N-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 168636902) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 168636902 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[4-[(3-chloro-2-hydroxypropyl)amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(NCC(O)CCl)cc1 |
| InChI | InChI=1S/C15H22ClN3O3/c16-9-14(20)10-17-12-1-3-13(4-2-12)18-15(21)11-19-5-7-22-8-6-19/h1-4,14,17,20H,5-11H2,(H,18,21) |
| InChIKey | HBFYUWVPHRYQCD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|