C20H23Cl2N3O2S — CID 23105319
3-chloro-N-[3-(3-chloro-4-pyrrolidin-1-ylanilino)-2-hydroxypropyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide (PubChem CID 23105319) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is 3-chloro-N-[3-(3-chloro-4-pyrrolidin-1-ylanilino)-2-hydroxypropyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 3-chloro-N-[3-(3-chloro-4-pyrrolidin-1-ylanilino)-2-hydroxypropyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 23105319 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 3-chloro-N-[3-(3-chloro-4-pyrrolidin-1-ylanilino)-2-hydroxypropyl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(NCC(O)CNc1ccc(N2CCCC2)c(Cl)c1)C1=CC(Cl)=CCC1=S |
| InChI | InChI=1S/C20H23Cl2N3O2S/c21-13-3-6-19(28)16(9-13)20(27)24-12-15(26)11-23-14-4-5-18(17(22)10-14)25-7-1-2-8-25/h3-5,9-10,15,23,26H,1-2,6-8,11-12H2,(H,24,27) |
| InChIKey | OFYSPMACFLUSTD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|