C21H21ClN4O — CID 52692836
N-(3-chloro-4-piperidin-1-ylphenyl)-1-phenylpyrazole-3-carboxamide (PubChem CID 52692836) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 52692836 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-1-phenylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(Cl)c1)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21ClN4O/c22-18-15-16(9-10-20(18)25-12-5-2-6-13-25)23-21(27)19-11-14-26(24-19)17-7-3-1-4-8-17/h1,3-4,7-11,14-15H,2,5-6,12-13H2,(H,23,27) |
| InChIKey | HUKDFIMRNMZFNH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|