C17H13F2N3O2 — CID 47028819
N-[4-(difluoromethoxy)phenyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 47028819) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47028819 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-17(19)24-14-8-6-12(7-9-14)20-16(23)15-10-11-22(21-15)13-4-2-1-3-5-13/h1-11,17H,(H,20,23) |
| InChIKey | OYVIVFGDISIEIM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |